# Chemical Compound

A compound's identity card by name — formula, weight, structure keys, straight from PubChem.

- Method: `GET`
- Path: `/v1/science/compound`

**Parameters**

| Name | Type | | Description |
|---|---|---|---|
| `name` | string | required | A compound name, common or systematic. |
| `max_age` | integer (seconds) | optional | Ask for data no older than this. Clamped to the product's own floor, so it can narrow the window but never force a refresh on every call. |

**Example request**

```bash
curl https://api.diraz.ae/v1/science/compound \
  -H "Authorization: Bearer drz_live_…"
```

**Example response**

```json
{
  "data": {
    "cid": 2519,
    "name": "caffeine",
    "molecular_formula": "C8H10N4O2",
    "molecular_weight": "194.19",
    "inchi_key": "RYYVLZVUVIJVGH-UHFFFAOYSA-N",
    "canonical_smiles": "CN1C=NC2=C1C(=O)N(C)C(=O)N2C",
    "url": "https://pubchem.ncbi.nlm.nih.gov/compound/2519"
  },
  "meta": {
    "request_id": "req_7Q2fK4mZ",
    "as_of": "2026-08-22T04:05:00.000Z",
    "age_seconds": 42,
    "next_update_at": "2026-08-23T04:05:00.000Z"
  }
}
```